About triethyl trimethylsilyl silicate
triethyl trimethylsilyl silicate (PubChem CID 13424769) has the molecular formula C9H24O4Si2
and a molecular weight of 252.46 g/mol. Its IUPAC name is triethyl trimethylsilyl silicate.
Molecular Properties
| Compound Name | triethyl trimethylsilyl silicate |
| PubChem CID | 13424769 |
| Molecular Formula | C9H24O4Si2 |
| Molecular Weight | 252.46 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | triethyl trimethylsilyl silicate |
| SMILES | CCO[Si](OCC)(OCC)O[Si](C)(C)C |
| InChI | InChI=1S/C9H24O4Si2/c1-7-10-15(11-8-2,12-9-3)13-14(4,5)6/h7-9H2,1-6H3 |
| InChIKey | OPVRXFLDMSPNDD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl trimethylsilyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl trimethylsilyl silicate?
The IUPAC name of triethyl trimethylsilyl silicate (CID 13424769) is triethyl trimethylsilyl silicate.
What is the SMILES notation for triethyl trimethylsilyl silicate?
The canonical SMILES for triethyl trimethylsilyl silicate is CCO[Si](OCC)(OCC)O[Si](C)(C)C.
What is the InChIKey of triethyl trimethylsilyl silicate?
The InChIKey is OPVRXFLDMSPNDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H24O4Si2/c1-7-10-15(11-8-2,12-9-3)13-14(4,5)6/h7-9H2,1-6H3.
What are the key properties of triethyl trimethylsilyl silicate?
triethyl trimethylsilyl silicate has a molecular weight of 252.46 g/mol, XLogP of 2.38, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl trimethylsilyl silicate is sourced from PubChem (CID 13424769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).