C17H13F13S — CID 134248883
1-ethenyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-ylsulfanylmethyl)benzene (PubChem CID 134248883) has the molecular formula C17H13F13S and a molecular weight of 496.33 g/mol. Its IUPAC name is 1-ethenyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-ylsulfanylmethyl)benzene.
| Compound Name | 1-ethenyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-ylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 134248883 |
| Molecular Formula | C17H13F13S |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 1-ethenyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-ylsulfanylmethyl)benzene |
| SMILES | C=Cc1ccccc1CSC(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H13F13S/c1-3-10-6-4-5-7-11(10)8-31-9(2)12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h3-7,9H,1,8H2,2H3 |
| InChIKey | ZZZOIPXAVMEFCM-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|