C15H21N3O3 — CID 134249360
6-methylidene-1,3-bis(2-methylprop-2-enyl)-5-(2-oxopropyl)-1,3,5-triazinane-2,4-dione (PubChem CID 134249360) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 6-methylidene-1,3-bis(2-methylprop-2-enyl)-5-(2-oxopropyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-methylidene-1,3-bis(2-methylprop-2-enyl)-5-(2-oxopropyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 134249360 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 6-methylidene-1,3-bis(2-methylprop-2-enyl)-5-(2-oxopropyl)-1,3,5-triazinane-2,4-dione |
| SMILES | C=C(C)CN1C(=C)N(CC(C)=O)C(=O)N(CC(=C)C)C1=O |
| InChI | InChI=1S/C15H21N3O3/c1-10(2)7-16-13(6)17(9-12(5)19)15(21)18(14(16)20)8-11(3)4/h1,3,6-9H2,2,4-5H3 |
| InChIKey | NSNMJTDGOHYEDH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|