C14H15F2NO3 — CID 134249432
[1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate (PubChem CID 134249432) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is [1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate.
| Compound Name | [1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 134249432 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate |
| SMILES | O=C(OCC1CCN(C(=O)C(F)F)C1)c1ccccc1 |
| InChI | InChI=1S/C14H15F2NO3/c15-12(16)13(18)17-7-6-10(8-17)9-20-14(19)11-4-2-1-3-5-11/h1-5,10,12H,6-9H2 |
| InChIKey | QUNIFKZVTGRYRH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |