About [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate
[(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate (PubChem CID 134249435) has the molecular formula C14H15F2NO3
and a molecular weight of 283.27 g/mol. Its IUPAC name is [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate.
Molecular Properties
| Compound Name | [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate |
| PubChem CID | 134249435 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1CCN(C(=O)C(F)F)C1)c1ccccc1 |
| InChI | InChI=1S/C14H15F2NO3/c15-12(16)13(18)17-7-6-10(8-17)9-20-14(19)11-4-2-1-3-5-11/h1-5,10,12H,6-9H2/t10-/m0/s1 |
| InChIKey | QUNIFKZVTGRYRH-JTQLQIEISA-N |
| XLogP | 1.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate?
The IUPAC name of [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate (CID 134249435) is [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate.
What is the SMILES notation for [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate?
The canonical SMILES for [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate is O=C(OC[C@H]1CCN(C(=O)C(F)F)C1)c1ccccc1.
What is the InChIKey of [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate?
The InChIKey is QUNIFKZVTGRYRH-JTQLQIEISA-N. The full InChI is InChI=1S/C14H15F2NO3/c15-12(16)13(18)17-7-6-10(8-17)9-20-14(19)11-4-2-1-3-5-11/h1-5,10,12H,6-9H2/t10-/m0/s1.
What are the key properties of [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate?
[(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate has a molecular weight of 283.27 g/mol, XLogP of 1.96, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-(2,2-difluoroacetyl)pyrrolidin-3-yl]methyl benzoate is sourced from PubChem (CID 134249435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).