C22H27ClO7 — CID 134249792
2-[[(3R,5aR,6R,7R,8aS)-6-[(E)-4-(3-chlorophenoxy)-3-oxobut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]acetic acid (PubChem CID 134249792) has the molecular formula C22H27ClO7 and a molecular weight of 438.90 g/mol. Its IUPAC name is 2-[[(3R,5aR,6R,7R,8aS)-6-[(E)-4-(3-chlorophenoxy)-3-oxobut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]acetic acid.
| Compound Name | 2-[[(3R,5aR,6R,7R,8aS)-6-[(E)-4-(3-chlorophenoxy)-3-oxobut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 134249792 |
| Molecular Formula | C22H27ClO7 |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-[[(3R,5aR,6R,7R,8aS)-6-[(E)-4-(3-chlorophenoxy)-3-oxobut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]acetic acid |
| SMILES | O=C(O)COC[C@H]1CC[C@@H]2[C@@H](/C=C/C(=O)COc3cccc(Cl)c3)[C@H](O)C[C@@H]2OC1 |
| InChI | InChI=1S/C22H27ClO7/c23-15-2-1-3-17(8-15)29-12-16(24)5-7-18-19-6-4-14(10-28-13-22(26)27)11-30-21(19)9-20(18)25/h1-3,5,7-8,14,18-21,25H,4,6,9-13H2,(H,26,27)/b7-5+/t14-,18-,19-,20-,21+/m1/s1 |
| InChIKey | KTSQGACRYBONJC-YUEVPYMZSA-N |
| XLogP | 2.74 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|