About N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine
N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine (PubChem CID 134250067) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine.
Molecular Properties
| Compound Name | N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine |
| PubChem CID | 134250067 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine |
| SMILES | C=C(C/C=C/C(C)CC(C)C)NC1CC=C(C)CC1CC |
| InChI | InChI=1S/C20H35N/c1-7-19-14-17(5)11-12-20(19)21-18(6)10-8-9-16(4)13-15(2)3/h8-9,11,15-16,19-21H,6-7,10,12-14H2,1-5H3/b9-8+ |
| InChIKey | VXEIXXKLNSMDHS-CMDGGOBGSA-N |
| XLogP | 5.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine?
The IUPAC name of N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine (CID 134250067) is N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine.
What is the SMILES notation for N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine?
The canonical SMILES for N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine is C=C(C/C=C/C(C)CC(C)C)NC1CC=C(C)CC1CC.
What is the InChIKey of N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine?
The InChIKey is VXEIXXKLNSMDHS-CMDGGOBGSA-N. The full InChI is InChI=1S/C20H35N/c1-7-19-14-17(5)11-12-20(19)21-18(6)10-8-9-16(4)13-15(2)3/h8-9,11,15-16,19-21H,6-7,10,12-14H2,1-5H3/b9-8+.
What are the key properties of N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine?
N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine has a molecular weight of 289.51 g/mol, XLogP of 5.85, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4E)-6,8-dimethylnona-1,4-dien-2-yl]-6-ethyl-4-methylcyclohex-3-en-1-amine is sourced from PubChem (CID 134250067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).