C22H45N — CID 134250206
(3S,9S)-N,3,4,5,6,6,7,8,9-nonamethyl-10-methylidenedodecan-2-amine (PubChem CID 134250206) has the molecular formula C22H45N and a molecular weight of 323.61 g/mol. Its IUPAC name is (3S,9S)-N,3,4,5,6,6,7,8,9-nonamethyl-10-methylidenedodecan-2-amine.
| Compound Name | (3S,9S)-N,3,4,5,6,6,7,8,9-nonamethyl-10-methylidenedodecan-2-amine |
|---|---|
| PubChem CID | 134250206 |
| Molecular Formula | C22H45N |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 323.36 |
| IUPAC Name | (3S,9S)-N,3,4,5,6,6,7,8,9-nonamethyl-10-methylidenedodecan-2-amine |
| SMILES | C=C(CC)[C@@H](C)C(C)C(C)C(C)(C)C(C)C(C)[C@H](C)C(C)NC |
| InChI | InChI=1S/C22H45N/c1-13-14(2)15(3)16(4)19(7)22(10,11)20(8)17(5)18(6)21(9)23-12/h15-21,23H,2,13H2,1,3-12H3/t15-,16?,17?,18+,19?,20?,21?/m1/s1 |
| InChIKey | SMAPHAINUDERJH-OSHUFQDDSA-N |
| XLogP | 6.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|