C8H15NO5 — CID 134250543
N-[2-[(2S,3S,4R)-3,4-dihydroxyoxan-2-yl]oxyethyl]formamide (PubChem CID 134250543) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is N-[2-[(2S,3S,4R)-3,4-dihydroxyoxan-2-yl]oxyethyl]formamide.
| Compound Name | N-[2-[(2S,3S,4R)-3,4-dihydroxyoxan-2-yl]oxyethyl]formamide |
|---|---|
| PubChem CID | 134250543 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | N-[2-[(2S,3S,4R)-3,4-dihydroxyoxan-2-yl]oxyethyl]formamide |
| SMILES | O=CNCCO[C@@H]1OCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H15NO5/c10-5-9-2-4-14-8-7(12)6(11)1-3-13-8/h5-8,11-12H,1-4H2,(H,9,10)/t6-,7+,8+/m1/s1 |
| InChIKey | HNSRXHDYUHUVBL-CSMHCCOUSA-N |
| XLogP | -1.78 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|