C13H14N4O — CID 13425121
2-(cyclopropylmethyl)-2,4,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,10,12-tetraen-8-one (PubChem CID 13425121) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-2,4,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,10,12-tetraen-8-one.
| Compound Name | 2-(cyclopropylmethyl)-2,4,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,10,12-tetraen-8-one |
|---|---|
| PubChem CID | 13425121 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(cyclopropylmethyl)-2,4,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,10,12-tetraen-8-one |
| SMILES | O=C1c2cccnc2N(CC2CC2)C2=NCCN12 |
| InChI | InChI=1S/C13H14N4O/c18-12-10-2-1-5-14-11(10)17(8-9-3-4-9)13-15-6-7-16(12)13/h1-2,5,9H,3-4,6-8H2 |
| InChIKey | CBQUAEHHWTYILZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |