C15H13N5O2 — CID 134251333
5-[[2-(buta-1,3-dien-2-ylamino)pyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one (PubChem CID 134251333) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is 5-[[2-(buta-1,3-dien-2-ylamino)pyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[[2-(buta-1,3-dien-2-ylamino)pyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 134251333 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-[[2-(buta-1,3-dien-2-ylamino)pyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one |
| SMILES | C=CC(=C)Nc1nccc(Nc2ccc3oc(=O)[nH]c3c2)n1 |
| InChI | InChI=1S/C15H13N5O2/c1-3-9(2)17-14-16-7-6-13(20-14)18-10-4-5-12-11(8-10)19-15(21)22-12/h3-8H,1-2H2,(H,19,21)(H2,16,17,18,20) |
| InChIKey | AHVJYMYFAXXRSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|