About 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine
7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine (PubChem CID 134251605) has the molecular formula C16H14FNO
and a molecular weight of 255.29 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine.
Molecular Properties
| Compound Name | 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine |
| PubChem CID | 134251605 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine |
| SMILES | CC1=NOC(C)c2cc(-c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C16H14FNO/c1-10-15-8-5-13(9-16(15)11(2)19-18-10)12-3-6-14(17)7-4-12/h3-9,11H,1-2H3 |
| InChIKey | HCGKFDVLCNDEJZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine?
The IUPAC name of 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine (CID 134251605) is 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine.
What is the SMILES notation for 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine?
The canonical SMILES for 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine is CC1=NOC(C)c2cc(-c3ccc(F)cc3)ccc21.
What is the InChIKey of 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine?
The InChIKey is HCGKFDVLCNDEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO/c1-10-15-8-5-13(9-16(15)11(2)19-18-10)12-3-6-14(17)7-4-12/h3-9,11H,1-2H3.
What are the key properties of 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine?
7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine has a molecular weight of 255.29 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-fluorophenyl)-1,4-dimethyl-1H-2,3-benzoxazine is sourced from PubChem (CID 134251605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).