C4H3N5O2 — CID 134252917
(4,6-dioxo-1H-1,3,5-triazin-2-yl)cyanamide (PubChem CID 134252917) has the molecular formula C4H3N5O2 and a molecular weight of 153.10 g/mol. Its IUPAC name is (4,6-dioxo-1H-1,3,5-triazin-2-yl)cyanamide.
| Compound Name | (4,6-dioxo-1H-1,3,5-triazin-2-yl)cyanamide |
|---|---|
| PubChem CID | 134252917 |
| Molecular Formula | C4H3N5O2 |
| Molecular Weight | 153.10 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | (4,6-dioxo-1H-1,3,5-triazin-2-yl)cyanamide |
| SMILES | N#CNc1nc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H3N5O2/c5-1-6-2-7-3(10)9-4(11)8-2/h(H3,6,7,8,9,10,11) |
| InChIKey | MBQGEBBYODGTNE-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.10 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|