C11H20FNO3 — CID 134253028
tert-butyl N-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]carbamate (PubChem CID 134253028) has the molecular formula C11H20FNO3 and a molecular weight of 233.28 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 134253028 |
| Molecular Formula | C11H20FNO3 |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | tert-butyl N-[(1S,2S,5R)-2-fluoro-5-hydroxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](O)CC[C@@H]1F |
| InChI | InChI=1S/C11H20FNO3/c1-11(2,3)16-10(15)13-9-6-7(14)4-5-8(9)12/h7-9,14H,4-6H2,1-3H3,(H,13,15)/t7-,8+,9+/m1/s1 |
| InChIKey | UFRMTRCCTDLODS-VGMNWLOBSA-N |
| XLogP | 1.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |