C6H11ClFNO — CID 134253032
(1R,3S,4S)-3-(chloroamino)-4-fluorocyclohexan-1-ol (PubChem CID 134253032) has the molecular formula C6H11ClFNO and a molecular weight of 167.61 g/mol. Its IUPAC name is (1R,3S,4S)-3-(chloroamino)-4-fluorocyclohexan-1-ol.
| Compound Name | (1R,3S,4S)-3-(chloroamino)-4-fluorocyclohexan-1-ol |
|---|---|
| PubChem CID | 134253032 |
| Molecular Formula | C6H11ClFNO |
| Molecular Weight | 167.61 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | (1R,3S,4S)-3-(chloroamino)-4-fluorocyclohexan-1-ol |
| SMILES | O[C@@H]1CC[C@H](F)[C@@H](NCl)C1 |
| InChI | InChI=1S/C6H11ClFNO/c7-9-6-3-4(10)1-2-5(6)8/h4-6,9-10H,1-3H2/t4-,5+,6+/m1/s1 |
| InChIKey | DOUALYPGOXKNOB-SRQIZXRXSA-N |
| XLogP | 0.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.61 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|