C10H9Cl2N3O2 — CID 134253432
1-(3,5-dichloro-4-pyridinyl)-1,4-diazepane-2,7-dione (PubChem CID 134253432) has the molecular formula C10H9Cl2N3O2 and a molecular weight of 274.11 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-pyridinyl)-1,4-diazepane-2,7-dione.
| Compound Name | 1-(3,5-dichloro-4-pyridinyl)-1,4-diazepane-2,7-dione |
|---|---|
| PubChem CID | 134253432 |
| Molecular Formula | C10H9Cl2N3O2 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 1-(3,5-dichloro-4-pyridinyl)-1,4-diazepane-2,7-dione |
| SMILES | O=C1CCNCC(=O)N1c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C10H9Cl2N3O2/c11-6-3-14-4-7(12)10(6)15-8(16)1-2-13-5-9(15)17/h3-4,13H,1-2,5H2 |
| InChIKey | MQUQOKYCSLYYFA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|