C30H46F2O3 — CID 134253525
7,7-difluoro-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid (PubChem CID 134253525) has the molecular formula C30H46F2O3 and a molecular weight of 492.69 g/mol. Its IUPAC name is 7,7-difluoro-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid.
| Compound Name | 7,7-difluoro-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 134253525 |
| Molecular Formula | C30H46F2O3 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | 7,7-difluoro-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CC(F)(F)C43C)C2C1C |
| InChI | InChI=1S/C30H46F2O3/c1-17-10-13-29(24(34)35)15-14-27(6)19(23(29)18(17)2)8-9-20-26(5)12-11-22(33)25(3,4)21(26)16-30(31,32)28(20,27)7/h8,17-18,20-23,33H,9-16H2,1-7H3,(H,34,35) |
| InChIKey | QHPOHFUOBWJXOV-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|