About N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide
N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide (PubChem CID 134254176) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide.
Molecular Properties
| Compound Name | N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide |
| PubChem CID | 134254176 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide |
| SMILES | C=C(N)/C(N/C=N/CC)=C(C)\N=C\C |
| InChI | InChI=1S/C10H18N4/c1-5-12-7-14-10(8(3)11)9(4)13-6-2/h6-7H,3,5,11H2,1-2,4H3,(H,12,14)/b10-9+,13-6+ |
| InChIKey | JOWQSRUTQGQXRC-SLJQOXHMSA-N |
| XLogP | 1.42 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide?
The IUPAC name of N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide (CID 134254176) is N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide.
What is the SMILES notation for N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide?
The canonical SMILES for N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide is C=C(N)/C(N/C=N/CC)=C(C)\N=C\C.
What is the InChIKey of N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide?
The InChIKey is JOWQSRUTQGQXRC-SLJQOXHMSA-N. The full InChI is InChI=1S/C10H18N4/c1-5-12-7-14-10(8(3)11)9(4)13-6-2/h6-7H,3,5,11H2,1-2,4H3,(H,12,14)/b10-9+,13-6+.
What are the key properties of N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide?
N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide has a molecular weight of 194.28 g/mol, XLogP of 1.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-2-amino-4-(ethylideneamino)penta-1,3-dien-3-yl]-N'-ethylmethanimidamide is sourced from PubChem (CID 134254176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).