C27H24F3N7O — CID 134254376
N-[6-(2-methylpyrazol-3-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 134254376) has the molecular formula C27H24F3N7O and a molecular weight of 519.53 g/mol. Its IUPAC name is N-[6-(2-methylpyrazol-3-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-[6-(2-methylpyrazol-3-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 134254376 |
| Molecular Formula | C27H24F3N7O |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | N-[6-(2-methylpyrazol-3-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cn1nccc1-c1cccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CCC2CC3)n1 |
| InChI | InChI=1S/C27H24F3N7O/c1-35-22(10-13-31-35)21-6-3-7-24(32-21)34-26(38)37-19-11-14-36(15-12-19)23-9-8-20(33-25(23)37)17-4-2-5-18(16-17)27(28,29)30/h2-10,13,16,19H,11-12,14-15H2,1H3,(H,32,34,38) |
| InChIKey | QCBNTLLWSHTPSK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |