C13H23N — CID 134254927
(2E,4Z)-N,2,5-trimethyl-N-propan-2-ylhepta-2,4,6-trien-1-amine (PubChem CID 134254927) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (2E,4Z)-N,2,5-trimethyl-N-propan-2-ylhepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z)-N,2,5-trimethyl-N-propan-2-ylhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 134254927 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (2E,4Z)-N,2,5-trimethyl-N-propan-2-ylhepta-2,4,6-trien-1-amine |
| SMILES | C=C/C(C)=C\C=C(/C)CN(C)C(C)C |
| InChI | InChI=1S/C13H23N/c1-7-12(4)8-9-13(5)10-14(6)11(2)3/h7-9,11H,1,10H2,2-6H3/b12-8-,13-9+ |
| InChIKey | TZOMEEBJHZXYRH-QRBCZBMESA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|