C48H84O6 — CID 134254946
[2-[(2-ethyl-2-methylpentanoyl)oxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 134254946) has the molecular formula C48H84O6 and a molecular weight of 757.19 g/mol. Its IUPAC name is [2-[(2-ethyl-2-methylpentanoyl)oxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[(2-ethyl-2-methylpentanoyl)oxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 134254946 |
| Molecular Formula | C48H84O6 |
| Molecular Weight | 757.19 g/mol |
| Exact Mass | 756.63 |
| IUPAC Name | [2-[(2-ethyl-2-methylpentanoyl)oxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)COC(=O)C(C)(CC)CCC |
| InChI | InChI=1S/C48H84O6/c1-6-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-45(49)52-41-44(43-54-47(51)48(5,9-4)40-8-3)42-53-46(50)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-7-2/h16-19,22-25,44H,6-15,20-21,26-43H2,1-5H3/b18-16-,19-17-,24-22-,25-23- |
| InChIKey | XVIXRNHFXKFZQA-HBZIWDQGSA-N |
| XLogP | 14.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.19 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|