C15H19NS — CID 13425508
(3aR,5R,6R,7aS)-5,6-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole (PubChem CID 13425508) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-5,6-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole.
| Compound Name | (3aR,5R,6R,7aS)-5,6-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 13425508 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (3aR,5R,6R,7aS)-5,6-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
| SMILES | C[C@@H]1C[C@@H]2SC(c3ccccc3)=N[C@@H]2C[C@H]1C |
| InChI | InChI=1S/C15H19NS/c1-10-8-13-14(9-11(10)2)17-15(16-13)12-6-4-3-5-7-12/h3-7,10-11,13-14H,8-9H2,1-2H3/t10-,11-,13-,14+/m1/s1 |
| InChIKey | AASXMLCMBYNSLT-OXHZDVMGSA-N |
| XLogP | 3.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |