C22H23F3N2O4 — CID 134255158
1-[2-[[7-methyl-5-[(2E,4Z)-6-(trifluoromethoxy)hepta-2,4,6-trien-3-yl]-1,2-benzoxazol-3-yl]oxy]ethyl]pyrrolidin-2-one (PubChem CID 134255158) has the molecular formula C22H23F3N2O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is 1-[2-[[7-methyl-5-[(2E,4Z)-6-(trifluoromethoxy)hepta-2,4,6-trien-3-yl]-1,2-benzoxazol-3-yl]oxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[[7-methyl-5-[(2E,4Z)-6-(trifluoromethoxy)hepta-2,4,6-trien-3-yl]-1,2-benzoxazol-3-yl]oxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 134255158 |
| Molecular Formula | C22H23F3N2O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[2-[[7-methyl-5-[(2E,4Z)-6-(trifluoromethoxy)hepta-2,4,6-trien-3-yl]-1,2-benzoxazol-3-yl]oxy]ethyl]pyrrolidin-2-one |
| SMILES | C=C(/C=C\C(=C/C)c1cc(C)c2onc(OCCN3CCCC3=O)c2c1)OC(F)(F)F |
| InChI | InChI=1S/C22H23F3N2O4/c1-4-16(8-7-15(3)30-22(23,24)25)17-12-14(2)20-18(13-17)21(26-31-20)29-11-10-27-9-5-6-19(27)28/h4,7-8,12-13H,3,5-6,9-11H2,1-2H3/b8-7-,16-4+ |
| InChIKey | LHNDTXVQCSNILK-YMTBWGIISA-N |
| XLogP | 5.15 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|