C16H14F3N3O2 — CID 134255382
3,4-dimethyl-1-[2-phenyl-3-(trifluoromethyl)-3,4-dihydropyrazol-5-yl]pyrrole-2,5-dione (PubChem CID 134255382) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is 3,4-dimethyl-1-[2-phenyl-3-(trifluoromethyl)-3,4-dihydropyrazol-5-yl]pyrrole-2,5-dione.
| Compound Name | 3,4-dimethyl-1-[2-phenyl-3-(trifluoromethyl)-3,4-dihydropyrazol-5-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 134255382 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3,4-dimethyl-1-[2-phenyl-3-(trifluoromethyl)-3,4-dihydropyrazol-5-yl]pyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(C2=NN(c3ccccc3)C(C(F)(F)F)C2)C1=O |
| InChI | InChI=1S/C16H14F3N3O2/c1-9-10(2)15(24)21(14(9)23)13-8-12(16(17,18)19)22(20-13)11-6-4-3-5-7-11/h3-7,12H,8H2,1-2H3 |
| InChIKey | NGGMSEIBWXYOJS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|