C36H22N4O2S2 — CID 134255387
4-[5-(1,5-diphenylpyrrolo[2,3-f]indol-2-yl)thiophen-2-yl]-1-thiophen-2-yl-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 134255387) has the molecular formula C36H22N4O2S2 and a molecular weight of 606.73 g/mol. Its IUPAC name is 4-[5-(1,5-diphenylpyrrolo[2,3-f]indol-2-yl)thiophen-2-yl]-1-thiophen-2-yl-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 4-[5-(1,5-diphenylpyrrolo[2,3-f]indol-2-yl)thiophen-2-yl]-1-thiophen-2-yl-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 134255387 |
| Molecular Formula | C36H22N4O2S2 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | 4-[5-(1,5-diphenylpyrrolo[2,3-f]indol-2-yl)thiophen-2-yl]-1-thiophen-2-yl-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | O=C1NC(c2ccc(-c3cc4cc5c(ccn5-c5ccccc5)cc4n3-c3ccccc3)s2)=C2C(=O)NC(c3cccs3)=C12 |
| InChI | InChI=1S/C36H22N4O2S2/c41-35-31-32(36(42)37-33(31)29-12-7-17-43-29)34(38-35)30-14-13-28(44-30)27-20-22-19-25-21(15-16-39(25)23-8-3-1-4-9-23)18-26(22)40(27)24-10-5-2-6-11-24/h1-20H,(H,37,42)(H,38,41) |
| InChIKey | BCJISLYBGJKQDZ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|