C43H80N2 — CID 134255433
N-methyl-4-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]iminobutan-1-amine (PubChem CID 134255433) has the molecular formula C43H80N2 and a molecular weight of 625.13 g/mol. Its IUPAC name is N-methyl-4-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]iminobutan-1-amine.
| Compound Name | N-methyl-4-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]iminobutan-1-amine |
|---|---|
| PubChem CID | 134255433 |
| Molecular Formula | C43H80N2 |
| Molecular Weight | 625.13 g/mol |
| Exact Mass | 624.63 |
| IUPAC Name | N-methyl-4-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]iminobutan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)C/N=C/CCCNC |
| InChI | InChI=1S/C43H80N2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-43(42-45-41-37-36-40-44-3)39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41,43-44H,4-11,16-17,22-40,42H2,1-3H3/b14-12-,15-13-,20-18-,21-19-,45-41+ |
| InChIKey | HRYHMRIOLADPMH-LTRDWOPSSA-N |
| XLogP | 14.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.13 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|