About (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene
(1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene (PubChem CID 134255763) has the molecular formula C19H25F3O2
and a molecular weight of 342.40 g/mol. Its IUPAC name is (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene.
Molecular Properties
| Compound Name | (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene |
| PubChem CID | 134255763 |
| Molecular Formula | C19H25F3O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene |
| SMILES | COc1cc(OC)c(/C2=C/CCCCCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H25F3O2/c1-23-15-12-16(19(20,21)22)18(17(13-15)24-2)14-10-8-6-4-3-5-7-9-11-14/h10,12-13H,3-9,11H2,1-2H3/b14-10+ |
| InChIKey | YIWOEUIDJZOUEP-GXDHUFHOSA-N |
| XLogP | 6.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene?
The IUPAC name of (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene (CID 134255763) is (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene.
What is the SMILES notation for (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene?
The canonical SMILES for (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene is COc1cc(OC)c(/C2=C/CCCCCCCC2)c(C(F)(F)F)c1.
What is the InChIKey of (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene?
The InChIKey is YIWOEUIDJZOUEP-GXDHUFHOSA-N. The full InChI is InChI=1S/C19H25F3O2/c1-23-15-12-16(19(20,21)22)18(17(13-15)24-2)14-10-8-6-4-3-5-7-9-11-14/h10,12-13H,3-9,11H2,1-2H3/b14-10+.
What are the key properties of (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene?
(1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene has a molecular weight of 342.40 g/mol, XLogP of 6.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-[2,4-dimethoxy-6-(trifluoromethyl)phenyl]cyclodecene is sourced from PubChem (CID 134255763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).