C22H24N6O5 — CID 134256035
N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-formyl-6-[[formyl(methyl)amino]methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 134256035) has the molecular formula C22H24N6O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-formyl-6-[[formyl(methyl)amino]methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-formyl-6-[[formyl(methyl)amino]methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 134256035 |
| Molecular Formula | C22H24N6O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-formyl-6-[[formyl(methyl)amino]methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COCCOc1cc(NC(=O)N2CCCc3cc(CN(C)C=O)c(C=O)nc32)ncc1C#N |
| InChI | InChI=1S/C22H24N6O5/c1-27(14-30)12-16-8-15-4-3-5-28(21(15)25-18(16)13-29)22(31)26-20-9-19(33-7-6-32-2)17(10-23)11-24-20/h8-9,11,13-14H,3-7,12H2,1-2H3,(H,24,26,31) |
| InChIKey | HKNBWGQRQWWILF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|