C14H23N2P — CID 134256128
N-[(2,3-dimethyl-1,3-dihydroindol-2-yl)phosphanylmethyl]-N-methylethanamine (PubChem CID 134256128) has the molecular formula C14H23N2P and a molecular weight of 250.33 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1,3-dihydroindol-2-yl)phosphanylmethyl]-N-methylethanamine.
| Compound Name | N-[(2,3-dimethyl-1,3-dihydroindol-2-yl)phosphanylmethyl]-N-methylethanamine |
|---|---|
| PubChem CID | 134256128 |
| Molecular Formula | C14H23N2P |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | N-[(2,3-dimethyl-1,3-dihydroindol-2-yl)phosphanylmethyl]-N-methylethanamine |
| SMILES | CCN(C)CPC1(C)Nc2ccccc2C1C |
| InChI | InChI=1S/C14H23N2P/c1-5-16(4)10-17-14(3)11(2)12-8-6-7-9-13(12)15-14/h6-9,11,15,17H,5,10H2,1-4H3 |
| InChIKey | DBBIYGOEGKTTHO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|