About 1-buta-1,3-dien-2-ylcyclohexene
1-buta-1,3-dien-2-ylcyclohexene (PubChem CID 13425641) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-ylcyclohexene.
Molecular Properties
| Compound Name | 1-buta-1,3-dien-2-ylcyclohexene |
| PubChem CID | 13425641 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 1-buta-1,3-dien-2-ylcyclohexene |
| SMILES | C=CC(=C)C1=CCCCC1 |
| InChI | InChI=1S/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h3,7H,1-2,4-6,8H2 |
| InChIKey | QOJGYDVXHLYOSI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dien-2-ylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dien-2-ylcyclohexene?
The IUPAC name of 1-buta-1,3-dien-2-ylcyclohexene (CID 13425641) is 1-buta-1,3-dien-2-ylcyclohexene.
What is the SMILES notation for 1-buta-1,3-dien-2-ylcyclohexene?
The canonical SMILES for 1-buta-1,3-dien-2-ylcyclohexene is C=CC(=C)C1=CCCCC1.
What is the InChIKey of 1-buta-1,3-dien-2-ylcyclohexene?
The InChIKey is QOJGYDVXHLYOSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h3,7H,1-2,4-6,8H2.
What are the key properties of 1-buta-1,3-dien-2-ylcyclohexene?
1-buta-1,3-dien-2-ylcyclohexene has a molecular weight of 134.22 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dien-2-ylcyclohexene is sourced from PubChem (CID 13425641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).