C23H37N — CID 134256600
(3E,5Z,10Z,16E)-10-ethylidene-8,16-dimethylnonadeca-1,3,5,16,18-pentaen-4-amine (PubChem CID 134256600) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is (3E,5Z,10Z,16E)-10-ethylidene-8,16-dimethylnonadeca-1,3,5,16,18-pentaen-4-amine.
| Compound Name | (3E,5Z,10Z,16E)-10-ethylidene-8,16-dimethylnonadeca-1,3,5,16,18-pentaen-4-amine |
|---|---|
| PubChem CID | 134256600 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | (3E,5Z,10Z,16E)-10-ethylidene-8,16-dimethylnonadeca-1,3,5,16,18-pentaen-4-amine |
| SMILES | C=C/C=C(N)\C=C/CC(C)C/C(=C\C)CCCCC/C(C)=C/C=C |
| InChI | InChI=1S/C23H37N/c1-6-13-20(4)15-10-9-11-17-22(8-3)19-21(5)16-12-18-23(24)14-7-2/h6-8,12-14,18,21H,1-2,9-11,15-17,19,24H2,3-5H3/b18-12-,20-13+,22-8-,23-14+ |
| InChIKey | JHDOZMJCDDRMKH-YBEPDABFSA-N |
| XLogP | 7.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|