C15H21N — CID 134256758
N-[(4E,7Z,9Z)-3-methyl-6-methylidenedodeca-1,4,7,9-tetraen-4-yl]methanimine (PubChem CID 134256758) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-[(4E,7Z,9Z)-3-methyl-6-methylidenedodeca-1,4,7,9-tetraen-4-yl]methanimine.
| Compound Name | N-[(4E,7Z,9Z)-3-methyl-6-methylidenedodeca-1,4,7,9-tetraen-4-yl]methanimine |
|---|---|
| PubChem CID | 134256758 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-[(4E,7Z,9Z)-3-methyl-6-methylidenedodeca-1,4,7,9-tetraen-4-yl]methanimine |
| SMILES | C=CC(C)/C(=C\C(=C)/C=C\C=C/CC)N=C |
| InChI | InChI=1S/C15H21N/c1-6-8-9-10-11-13(3)12-15(16-5)14(4)7-2/h7-12,14H,2-3,5-6H2,1,4H3/b9-8-,11-10-,15-12+ |
| InChIKey | CFYXLOHMUSCQMC-DNTDQBGHSA-N |
| XLogP | 4.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|