5-iodothiophene-2-sulfonyl chloride

C4H2ClIO2S2 — CID 13425715

IUPAC5-iodothiophene-2-sulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(I)s1
InChIInChI=1S/C4H2ClIO2S2/c5-10(7,8)4-2-1-3(6)9-4/h1-2H
InChIKeyZPSQHBAYQRJYDZ-UHFFFAOYSA-N
MW308.55 g/mol
LogP2.28
Rot. Bonds1

About 5-iodothiophene-2-sulfonyl chloride

5-iodothiophene-2-sulfonyl chloride (PubChem CID 13425715) has the molecular formula C4H2ClIO2S2 and a molecular weight of 308.55 g/mol. Its IUPAC name is 5-iodothiophene-2-sulfonyl chloride.

Molecular Properties

Compound Name5-iodothiophene-2-sulfonyl chloride
PubChem CID13425715
Molecular FormulaC4H2ClIO2S2
Molecular Weight308.55 g/mol
Exact Mass307.82
IUPAC Name5-iodothiophene-2-sulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(I)s1
InChIInChI=1S/C4H2ClIO2S2/c5-10(7,8)4-2-1-3(6)9-4/h1-2H
InChIKeyZPSQHBAYQRJYDZ-UHFFFAOYSA-N
XLogP2.28
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.55
LogP ≤ 52.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 5-iodothiophene-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-Thiophenesulfonyl chloride
CID 85518
2-Methylsulfonylthiophene
CID 707933
Thiophene-3-sulfonyl Chloride
CID 2776378
Thiophene-2-sulfonyl fluoride
CID 19098976
2-Thiophenesulfonic acid, sodium salt
CID 23673643
3-Fluorothiophene-2-sulfonyl chloride
CID 15158653
5-Fluorothiophene-2-sulfonyl chloride
CID 45602174
2-(Ethylsulfonyl)-5-iodothiophene
CID 786878
2,5-Bis(methylsulfonyl)thiophene
CID 1281017
3-Iodothiophene-2-sulfonyl chloride
CID 21551506
4-Chloro-5-iodothiophene-2-sulfonyl chloride
CID 137966043
5-Iodothiophene-2-sulfonyl fluoride
CID 138040474

Frequently Asked Questions

What is the IUPAC name of 5-iodothiophene-2-sulfonyl chloride?
The IUPAC name of 5-iodothiophene-2-sulfonyl chloride (CID 13425715) is 5-iodothiophene-2-sulfonyl chloride.
What is the SMILES notation for 5-iodothiophene-2-sulfonyl chloride?
The canonical SMILES for 5-iodothiophene-2-sulfonyl chloride is O=S(=O)(Cl)c1ccc(I)s1.
What is the InChIKey of 5-iodothiophene-2-sulfonyl chloride?
The InChIKey is ZPSQHBAYQRJYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClIO2S2/c5-10(7,8)4-2-1-3(6)9-4/h1-2H.
What are the key properties of 5-iodothiophene-2-sulfonyl chloride?
5-iodothiophene-2-sulfonyl chloride has a molecular weight of 308.55 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodothiophene-2-sulfonyl chloride is sourced from PubChem (CID 13425715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).