C26H14F6N2O6S2 — CID 134257402
2,3-bis[(2,3,4-trifluorophenyl)sulfonylmethyl]-5a,9a-dihydrobenzo[g]quinoxaline-5,10-dione (PubChem CID 134257402) has the molecular formula C26H14F6N2O6S2 and a molecular weight of 628.53 g/mol. Its IUPAC name is 2,3-bis[(2,3,4-trifluorophenyl)sulfonylmethyl]-5a,9a-dihydrobenzo[g]quinoxaline-5,10-dione.
| Compound Name | 2,3-bis[(2,3,4-trifluorophenyl)sulfonylmethyl]-5a,9a-dihydrobenzo[g]quinoxaline-5,10-dione |
|---|---|
| PubChem CID | 134257402 |
| Molecular Formula | C26H14F6N2O6S2 |
| Molecular Weight | 628.53 g/mol |
| Exact Mass | 628.02 |
| IUPAC Name | 2,3-bis[(2,3,4-trifluorophenyl)sulfonylmethyl]-5a,9a-dihydrobenzo[g]quinoxaline-5,10-dione |
| SMILES | O=C1c2nc(CS(=O)(=O)c3ccc(F)c(F)c3F)c(CS(=O)(=O)c3ccc(F)c(F)c3F)nc2C(=O)C2C=CC=CC12 |
| InChI | InChI=1S/C26H14F6N2O6S2/c27-13-5-7-17(21(31)19(13)29)41(37,38)9-15-16(10-42(39,40)18-8-6-14(28)20(30)22(18)32)34-24-23(33-15)25(35)11-3-1-2-4-12(11)26(24)36/h1-8,11-12H,9-10H2 |
| InChIKey | JDYMVROKHTWWHJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 128.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|