C27H20F2N2O6S2 — CID 134257505
3-[[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]sulfonylmethyl]-2-[(2-fluorophenyl)sulfonylmethyl]benzo[g]quinoxaline-5,10-dione (PubChem CID 134257505) has the molecular formula C27H20F2N2O6S2 and a molecular weight of 570.60 g/mol. Its IUPAC name is 3-[[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]sulfonylmethyl]-2-[(2-fluorophenyl)sulfonylmethyl]benzo[g]quinoxaline-5,10-dione.
| Compound Name | 3-[[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]sulfonylmethyl]-2-[(2-fluorophenyl)sulfonylmethyl]benzo[g]quinoxaline-5,10-dione |
|---|---|
| PubChem CID | 134257505 |
| Molecular Formula | C27H20F2N2O6S2 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | 3-[[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]sulfonylmethyl]-2-[(2-fluorophenyl)sulfonylmethyl]benzo[g]quinoxaline-5,10-dione |
| SMILES | C=C/C(=C(F)\C=C/C)S(=O)(=O)Cc1nc2c(nc1CS(=O)(=O)c1ccccc1F)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H20F2N2O6S2/c1-3-9-18(28)22(4-2)38(34,35)14-20-21(15-39(36,37)23-13-8-7-12-19(23)29)31-25-24(30-20)26(32)16-10-5-6-11-17(16)27(25)33/h3-13H,2,14-15H2,1H3/b9-3-,22-18- |
| InChIKey | VHHJWBBIJLGCEJ-OOLNFXPWSA-N |
| XLogP | 4.22 |
| TPSA | 128.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|