About 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine
7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine (PubChem CID 134257675) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine.
Molecular Properties
| Compound Name | 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine |
| PubChem CID | 134257675 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine |
| SMILES | CCC1=NN(C)C(C)CC=C1 |
| InChI | InChI=1S/C9H16N2/c1-4-9-7-5-6-8(2)11(3)10-9/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | GGLOBIFGDQHNRJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine?
The IUPAC name of 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine (CID 134257675) is 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine.
What is the SMILES notation for 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine?
The canonical SMILES for 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine is CCC1=NN(C)C(C)CC=C1.
What is the InChIKey of 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine?
The InChIKey is GGLOBIFGDQHNRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-9-7-5-6-8(2)11(3)10-9/h5,7-8H,4,6H2,1-3H3.
What are the key properties of 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine?
7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine has a molecular weight of 152.24 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2,3-dimethyl-3,4-dihydrodiazepine is sourced from PubChem (CID 134257675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).