About 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone
2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone (PubChem CID 134257820) has the molecular formula C22H21FN2O2
and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone.
Molecular Properties
| Compound Name | 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone |
| PubChem CID | 134257820 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone |
| SMILES | O=C(CC1c2c(F)cccc2-c2cncn21)C1CCC(c2ccoc2)CC1 |
| InChI | InChI=1S/C22H21FN2O2/c23-18-3-1-2-17-20-11-24-13-25(20)19(22(17)18)10-21(26)15-6-4-14(5-7-15)16-8-9-27-12-16/h1-3,8-9,11-15,19H,4-7,10H2 |
| InChIKey | OGYAIZWPQBCGQS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone?
The IUPAC name of 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone (CID 134257820) is 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone.
What is the SMILES notation for 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone?
The canonical SMILES for 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone is O=C(CC1c2c(F)cccc2-c2cncn21)C1CCC(c2ccoc2)CC1.
What is the InChIKey of 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone?
The InChIKey is OGYAIZWPQBCGQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21FN2O2/c23-18-3-1-2-17-20-11-24-13-25(20)19(22(17)18)10-21(26)15-6-4-14(5-7-15)16-8-9-27-12-16/h1-3,8-9,11-15,19H,4-7,10H2.
What are the key properties of 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone?
2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone has a molecular weight of 364.42 g/mol, XLogP of 5.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[4-(furan-3-yl)cyclohexyl]ethanone is sourced from PubChem (CID 134257820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).