About [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone
[(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 13425796) has the molecular formula C21H27NO2S
and a molecular weight of 357.52 g/mol. Its IUPAC name is [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone.
Molecular Properties
| Compound Name | [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone |
| PubChem CID | 13425796 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | COC[C@@H]1C[C@H](SC(C)(C)C)CN1C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H27NO2S/c1-21(2,3)25-17-12-16(14-24-4)22(13-17)20(23)19-11-7-9-15-8-5-6-10-18(15)19/h5-11,16-17H,12-14H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | WAFDQKLGFWIYDK-IRXDYDNUSA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone?
The IUPAC name of [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone (CID 13425796) is [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone.
What is the SMILES notation for [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone?
The canonical SMILES for [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone is COC[C@@H]1C[C@H](SC(C)(C)C)CN1C(=O)c1cccc2ccccc12.
What is the InChIKey of [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone?
The InChIKey is WAFDQKLGFWIYDK-IRXDYDNUSA-N. The full InChI is InChI=1S/C21H27NO2S/c1-21(2,3)25-17-12-16(14-24-4)22(13-17)20(23)19-11-7-9-15-8-5-6-10-18(15)19/h5-11,16-17H,12-14H2,1-4H3/t16-,17-/m0/s1.
What are the key properties of [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone?
[(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone has a molecular weight of 357.52 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-4-tert-butylsulfanyl-2-(methoxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone is sourced from PubChem (CID 13425796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).