C18H30N2O4 — CID 134257960
(2S)-2-[2-(ethenylamino)ethyl]-2-[methyl-[(3Z)-5-oxopenta-1,3-dien-2-yl]amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid (PubChem CID 134257960) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2S)-2-[2-(ethenylamino)ethyl]-2-[methyl-[(3Z)-5-oxopenta-1,3-dien-2-yl]amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid.
| Compound Name | (2S)-2-[2-(ethenylamino)ethyl]-2-[methyl-[(3Z)-5-oxopenta-1,3-dien-2-yl]amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 134257960 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (2S)-2-[2-(ethenylamino)ethyl]-2-[methyl-[(3Z)-5-oxopenta-1,3-dien-2-yl]amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
| SMILES | C=CNCC[C@](CCOC(C)(C)C)(C(=O)O)N(C)C(=C)/C=C\C=O |
| InChI | InChI=1S/C18H30N2O4/c1-7-19-12-10-18(16(22)23,11-14-24-17(3,4)5)20(6)15(2)9-8-13-21/h7-9,13,19H,1-2,10-12,14H2,3-6H3,(H,22,23)/b9-8-/t18-/m0/s1 |
| InChIKey | ILQQIGOFXUQYLW-GIFJBRJJSA-N |
| XLogP | 2.34 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|