C20H31N — CID 134258002
(3Z,6Z)-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-3,6-dimethyl-5-prop-1-enylnona-3,6-dien-2-imine (PubChem CID 134258002) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is (3Z,6Z)-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-3,6-dimethyl-5-prop-1-enylnona-3,6-dien-2-imine.
| Compound Name | (3Z,6Z)-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-3,6-dimethyl-5-prop-1-enylnona-3,6-dien-2-imine |
|---|---|
| PubChem CID | 134258002 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | (3Z,6Z)-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-3,6-dimethyl-5-prop-1-enylnona-3,6-dien-2-imine |
| SMILES | CC=CC(/C=C(C)\C(C)=N/C(C)=C/C=C\C)/C(C)=C\CC |
| InChI | InChI=1S/C20H31N/c1-8-11-14-18(6)21-19(7)17(5)15-20(13-10-3)16(4)12-9-2/h8,10-15,20H,9H2,1-7H3/b11-8-,13-10?,16-12-,17-15-,18-14+,21-19- |
| InChIKey | BCGNNUMTCUOQTA-JYPBPAGCSA-N |
| XLogP | 6.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|