C15H19ClN4O4S — CID 134258260
1-(4-chloro-2-methoxy-6-methylphenyl)-3-(1-propan-2-ylpyrazol-3-yl)sulfonylurea (PubChem CID 134258260) has the molecular formula C15H19ClN4O4S and a molecular weight of 386.86 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxy-6-methylphenyl)-3-(1-propan-2-ylpyrazol-3-yl)sulfonylurea.
| Compound Name | 1-(4-chloro-2-methoxy-6-methylphenyl)-3-(1-propan-2-ylpyrazol-3-yl)sulfonylurea |
|---|---|
| PubChem CID | 134258260 |
| Molecular Formula | C15H19ClN4O4S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 1-(4-chloro-2-methoxy-6-methylphenyl)-3-(1-propan-2-ylpyrazol-3-yl)sulfonylurea |
| SMILES | COc1cc(Cl)cc(C)c1NC(=O)NS(=O)(=O)c1ccn(C(C)C)n1 |
| InChI | InChI=1S/C15H19ClN4O4S/c1-9(2)20-6-5-13(18-20)25(22,23)19-15(21)17-14-10(3)7-11(16)8-12(14)24-4/h5-9H,1-4H3,(H2,17,19,21) |
| InChIKey | QIDCPJDRKLWVBF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |