C43H41N — CID 134259379
4-pentyl-N,N-bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]aniline (PubChem CID 134259379) has the molecular formula C43H41N and a molecular weight of 571.81 g/mol. Its IUPAC name is 4-pentyl-N,N-bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]aniline.
| Compound Name | 4-pentyl-N,N-bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]aniline |
|---|---|
| PubChem CID | 134259379 |
| Molecular Formula | C43H41N |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | 4-pentyl-N,N-bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]aniline |
| SMILES | CCCCCc1ccc(N(c2ccc(/C=C/C=C/c3ccccc3)cc2)c2ccc(/C=C/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C43H41N/c1-2-3-6-15-38-24-30-41(31-25-38)44(42-32-26-39(27-33-42)22-13-11-20-36-16-7-4-8-17-36)43-34-28-40(29-35-43)23-14-12-21-37-18-9-5-10-19-37/h4-5,7-14,16-35H,2-3,6,15H2,1H3/b20-11+,21-12+,22-13+,23-14+ |
| InChIKey | SLXXVBBPAWXRQD-KHYHXIBTSA-N |
| XLogP | 12.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|