C29H45O3P — CID 134260017
(1R,2R,5R,10S,14R,17S,18R,20S)-17-hydroxy-5-(hydroxymethyl)-1,2,14,18-tetramethyl-8-propan-2-yl-19-phosphahexacyclo[11.9.0.02,10.05,9.014,20.018,20]docos-8-en-7-one (PubChem CID 134260017) has the molecular formula C29H45O3P and a molecular weight of 472.65 g/mol. Its IUPAC name is (1R,2R,5R,10S,14R,17S,18R,20S)-17-hydroxy-5-(hydroxymethyl)-1,2,14,18-tetramethyl-8-propan-2-yl-19-phosphahexacyclo[11.9.0.02,10.05,9.014,20.018,20]docos-8-en-7-one.
| Compound Name | (1R,2R,5R,10S,14R,17S,18R,20S)-17-hydroxy-5-(hydroxymethyl)-1,2,14,18-tetramethyl-8-propan-2-yl-19-phosphahexacyclo[11.9.0.02,10.05,9.014,20.018,20]docos-8-en-7-one |
|---|---|
| PubChem CID | 134260017 |
| Molecular Formula | C29H45O3P |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | (1R,2R,5R,10S,14R,17S,18R,20S)-17-hydroxy-5-(hydroxymethyl)-1,2,14,18-tetramethyl-8-propan-2-yl-19-phosphahexacyclo[11.9.0.02,10.05,9.014,20.018,20]docos-8-en-7-one |
| SMILES | CC(C)C1=C2[C@H]3CCC4[C@@]5(C)CC[C@H](O)[C@@]6(C)P[C@@]56CC[C@@]4(C)[C@]3(C)CC[C@@]2(CO)CC1=O |
| InChI | InChI=1S/C29H45O3P/c1-17(2)22-19(31)15-28(16-30)13-11-24(3)18(23(22)28)7-8-20-25(24,4)12-14-29-26(20,5)10-9-21(32)27(29,6)33-29/h17-18,20-21,30,32-33H,7-16H2,1-6H3/t18-,20?,21+,24-,25-,26-,27-,28+,29+/m1/s1 |
| InChIKey | WRBSAIIQLODZJZ-BJTUXYDOSA-N |
| XLogP | 5.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|