About [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite
[(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite (PubChem CID 134260171) has the molecular formula C10H6F5IO2
and a molecular weight of 380.05 g/mol. Its IUPAC name is [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite.
Molecular Properties
| Compound Name | [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite |
| PubChem CID | 134260171 |
| Molecular Formula | C10H6F5IO2 |
| Molecular Weight | 380.05 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite |
| SMILES | O[C@H]1c2c(C(F)(F)F)ccc(OI)c2CC1(F)F |
| InChI | InChI=1S/C10H6F5IO2/c11-9(12)3-4-6(18-16)2-1-5(10(13,14)15)7(4)8(9)17/h1-2,8,17H,3H2/t8-/m0/s1 |
| InChIKey | VPXYXBMRZBNVCF-QMMMGPOBSA-N |
| XLogP | 3.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.05 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite?
The IUPAC name of [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite (CID 134260171) is [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite.
What is the SMILES notation for [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite?
The canonical SMILES for [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite is O[C@H]1c2c(C(F)(F)F)ccc(OI)c2CC1(F)F.
What is the InChIKey of [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite?
The InChIKey is VPXYXBMRZBNVCF-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H6F5IO2/c11-9(12)3-4-6(18-16)2-1-5(10(13,14)15)7(4)8(9)17/h1-2,8,17H,3H2/t8-/m0/s1.
What are the key properties of [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite?
[(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite has a molecular weight of 380.05 g/mol, XLogP of 3.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2-difluoro-1-hydroxy-7-(trifluoromethyl)-1,3-dihydroinden-4-yl] hypoiodite is sourced from PubChem (CID 134260171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).