C11H15NO2 — CID 134260202
(3E,4E)-3,4-di(ethylidene)-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 134260202) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3E,4E)-3,4-di(ethylidene)-1-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | (3E,4E)-3,4-di(ethylidene)-1-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134260202 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3E,4E)-3,4-di(ethylidene)-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | C/C=C1/C(=O)N(C(C)C)C(=O)/C1=C/C |
| InChI | InChI=1S/C11H15NO2/c1-5-8-9(6-2)11(14)12(7(3)4)10(8)13/h5-7H,1-4H3/b8-5+,9-6+ |
| InChIKey | XDCDPVUIHFGNGO-XVYDYJIPSA-N |
| XLogP | 1.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|