C22H27F3N2O — CID 134260604
N-(pyridin-4-ylmethyl)-2-[(3R)-3-[3-(trifluoromethyl)phenoxy]cyclohexyl]propan-1-amine (PubChem CID 134260604) has the molecular formula C22H27F3N2O and a molecular weight of 392.47 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-2-[(3R)-3-[3-(trifluoromethyl)phenoxy]cyclohexyl]propan-1-amine.
| Compound Name | N-(pyridin-4-ylmethyl)-2-[(3R)-3-[3-(trifluoromethyl)phenoxy]cyclohexyl]propan-1-amine |
|---|---|
| PubChem CID | 134260604 |
| Molecular Formula | C22H27F3N2O |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-2-[(3R)-3-[3-(trifluoromethyl)phenoxy]cyclohexyl]propan-1-amine |
| SMILES | CC(CNCc1ccncc1)C1CCC[C@@H](Oc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C22H27F3N2O/c1-16(14-27-15-17-8-10-26-11-9-17)18-4-2-6-20(12-18)28-21-7-3-5-19(13-21)22(23,24)25/h3,5,7-11,13,16,18,20,27H,2,4,6,12,14-15H2,1H3/t16?,18?,20-/m1/s1 |
| InChIKey | IWOWBHVAKISCRT-OUNSHVDWSA-N |
| XLogP | 5.46 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |