C10H24N4S — CID 134260983
1-(1,4,7,10-tetrazacyclododec-1-yl)ethanethiol (PubChem CID 134260983) has the molecular formula C10H24N4S and a molecular weight of 232.40 g/mol. Its IUPAC name is 1-(1,4,7,10-tetrazacyclododec-1-yl)ethanethiol.
| Compound Name | 1-(1,4,7,10-tetrazacyclododec-1-yl)ethanethiol |
|---|---|
| PubChem CID | 134260983 |
| Molecular Formula | C10H24N4S |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 1-(1,4,7,10-tetrazacyclododec-1-yl)ethanethiol |
| SMILES | CC(S)N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C10H24N4S/c1-10(15)14-8-6-12-4-2-11-3-5-13-7-9-14/h10-13,15H,2-9H2,1H3 |
| InChIKey | XSOZQWSLXLBNHQ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|