C17H15Cl6N5O2 — CID 134261255
[1-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]piperidin-4-yl]carbamic acid (PubChem CID 134261255) has the molecular formula C17H15Cl6N5O2 and a molecular weight of 534.06 g/mol. Its IUPAC name is [1-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 134261255 |
| Molecular Formula | C17H15Cl6N5O2 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 530.94 |
| IUPAC Name | [1-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(c2nc(-c3ccc(C(Cl)(Cl)Cl)cc3)nc(C(Cl)(Cl)Cl)n2)CC1 |
| InChI | InChI=1S/C17H15Cl6N5O2/c18-16(19,20)10-3-1-9(2-4-10)12-25-13(17(21,22)23)27-14(26-12)28-7-5-11(6-8-28)24-15(29)30/h1-4,11,24H,5-8H2,(H,29,30) |
| InChIKey | IGUDIUJHCRMVHG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|