C18H22N2O6 — CID 134261670
2-[5-(2,3-dimethylphenyl)-3-[2-(methoxymethoxy)ethyl]-2,4-dioxopyrimidin-1-yl]acetic acid (PubChem CID 134261670) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-[5-(2,3-dimethylphenyl)-3-[2-(methoxymethoxy)ethyl]-2,4-dioxopyrimidin-1-yl]acetic acid.
| Compound Name | 2-[5-(2,3-dimethylphenyl)-3-[2-(methoxymethoxy)ethyl]-2,4-dioxopyrimidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 134261670 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[5-(2,3-dimethylphenyl)-3-[2-(methoxymethoxy)ethyl]-2,4-dioxopyrimidin-1-yl]acetic acid |
| SMILES | COCOCCn1c(=O)c(-c2cccc(C)c2C)cn(CC(=O)O)c1=O |
| InChI | InChI=1S/C18H22N2O6/c1-12-5-4-6-14(13(12)2)15-9-19(10-16(21)22)18(24)20(17(15)23)7-8-26-11-25-3/h4-6,9H,7-8,10-11H2,1-3H3,(H,21,22) |
| InChIKey | FZGVMWJWQPLXND-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|