C26H22ClF3N2O5 — CID 134262045
4-[[(2R)-2-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-[(1S,2R)-2-methylcyclopropyl]propanoyl]amino]benzoic acid (PubChem CID 134262045) has the molecular formula C26H22ClF3N2O5 and a molecular weight of 534.92 g/mol. Its IUPAC name is 4-[[(2R)-2-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-[(1S,2R)-2-methylcyclopropyl]propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2R)-2-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-[(1S,2R)-2-methylcyclopropyl]propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 134262045 |
| Molecular Formula | C26H22ClF3N2O5 |
| Molecular Weight | 534.92 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 4-[[(2R)-2-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-[(1S,2R)-2-methylcyclopropyl]propanoyl]amino]benzoic acid |
| SMILES | C[C@@H]1C[C@H]1C[C@@H](C(=O)Nc1ccc(C(=O)O)cc1)c1ccc(-c2c(OC(F)F)ccc(Cl)c2F)c[n+]1[O-] |
| InChI | InChI=1S/C26H22ClF3N2O5/c1-13-10-16(13)11-18(24(33)31-17-5-2-14(3-6-17)25(34)35)20-8-4-15(12-32(20)36)22-21(37-26(29)30)9-7-19(27)23(22)28/h2-9,12-13,16,18,26H,10-11H2,1H3,(H,31,33)(H,34,35)/t13-,16+,18-/m1/s1 |
| InChIKey | CSPPCSXVVGHDSO-RPVQJOFSSA-N |
| XLogP | 5.85 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|